About methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate
methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate (PubChem CID 134900360) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate |
| PubChem CID | 134900360 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate |
| SMILES | COC(=O)[C@H](C)[C@@H]1O[C@H](C)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H20O3/c1-10-9-13(12-7-5-4-6-8-12)14(18-10)11(2)15(16)17-3/h4-8,10-11,13-14H,9H2,1-3H3/t10-,11-,13+,14+/m1/s1 |
| InChIKey | OQFSLCYWWZAEAC-RFHZTLPTSA-N |
| XLogP | 2.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate?
The IUPAC name of methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate (CID 134900360) is methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate.
What is the SMILES notation for methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate?
The canonical SMILES for methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate is COC(=O)[C@H](C)[C@@H]1O[C@H](C)C[C@H]1c1ccccc1.
What is the InChIKey of methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate?
The InChIKey is OQFSLCYWWZAEAC-RFHZTLPTSA-N. The full InChI is InChI=1S/C15H20O3/c1-10-9-13(12-7-5-4-6-8-12)14(18-10)11(2)15(16)17-3/h4-8,10-11,13-14H,9H2,1-3H3/t10-,11-,13+,14+/m1/s1.
What are the key properties of methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate?
methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate has a molecular weight of 248.32 g/mol, XLogP of 2.76, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-[(2R,3S,5R)-5-methyl-3-phenyloxolan-2-yl]propanoate is sourced from PubChem (CID 134900360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).