C13H16O4 — CID 134833790
[(4S,6S)-4-hydroxy-6-phenyloxan-2-yl] acetate (PubChem CID 134833790) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is [(4S,6S)-4-hydroxy-6-phenyloxan-2-yl] acetate.
| Compound Name | [(4S,6S)-4-hydroxy-6-phenyloxan-2-yl] acetate |
|---|---|
| PubChem CID | 134833790 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | [(4S,6S)-4-hydroxy-6-phenyloxan-2-yl] acetate |
| SMILES | CC(=O)OC1C[C@@H](O)C[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C13H16O4/c1-9(14)16-13-8-11(15)7-12(17-13)10-5-3-2-4-6-10/h2-6,11-13,15H,7-8H2,1H3/t11-,12-,13?/m0/s1 |
| InChIKey | HOFNAKIBJVPQLQ-VYAYZGMFSA-N |
| XLogP | 1.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |