C15H20O4 — CID 101247662
ethyl 2-[(2S,4S,6R)-4-hydroxy-6-phenyloxan-2-yl]acetate (PubChem CID 101247662) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is ethyl 2-[(2S,4S,6R)-4-hydroxy-6-phenyloxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2S,4S,6R)-4-hydroxy-6-phenyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 101247662 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | ethyl 2-[(2S,4S,6R)-4-hydroxy-6-phenyloxan-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C[C@H](O)C[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C15H20O4/c1-2-18-15(17)10-13-8-12(16)9-14(19-13)11-6-4-3-5-7-11/h3-7,12-14,16H,2,8-10H2,1H3/t12-,13-,14+/m0/s1 |
| InChIKey | NEWIDEKUNGJCSI-MELADBBJSA-N |
| XLogP | 2.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |