C13H16O4 — CID 10513963
ethyl (2R,3S,5R)-3-hydroxy-5-phenyloxolane-2-carboxylate (PubChem CID 10513963) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is ethyl (2R,3S,5R)-3-hydroxy-5-phenyloxolane-2-carboxylate.
| Compound Name | ethyl (2R,3S,5R)-3-hydroxy-5-phenyloxolane-2-carboxylate |
|---|---|
| PubChem CID | 10513963 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | ethyl (2R,3S,5R)-3-hydroxy-5-phenyloxolane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1O[C@@H](c2ccccc2)C[C@@H]1O |
| InChI | InChI=1S/C13H16O4/c1-2-16-13(15)12-10(14)8-11(17-12)9-6-4-3-5-7-9/h3-7,10-12,14H,2,8H2,1H3/t10-,11+,12+/m0/s1 |
| InChIKey | FRFGGLXMVIGXBC-QJPTWQEYSA-N |
| XLogP | 1.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |