C23H28O7S — CID 138968440
ethyl 2-[(2R,4R,6S)-6-(4-methoxyphenyl)-4-(4-methylphenyl)sulfonyloxyoxan-2-yl]acetate (PubChem CID 138968440) has the molecular formula C23H28O7S and a molecular weight of 448.54 g/mol. Its IUPAC name is ethyl 2-[(2R,4R,6S)-6-(4-methoxyphenyl)-4-(4-methylphenyl)sulfonyloxyoxan-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,4R,6S)-6-(4-methoxyphenyl)-4-(4-methylphenyl)sulfonyloxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 138968440 |
| Molecular Formula | C23H28O7S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | ethyl 2-[(2R,4R,6S)-6-(4-methoxyphenyl)-4-(4-methylphenyl)sulfonyloxyoxan-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C[C@@H](OS(=O)(=O)c2ccc(C)cc2)C[C@@H](c2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C23H28O7S/c1-4-28-23(24)15-19-13-20(30-31(25,26)21-11-5-16(2)6-12-21)14-22(29-19)17-7-9-18(27-3)10-8-17/h5-12,19-20,22H,4,13-15H2,1-3H3/t19-,20-,22+/m1/s1 |
| InChIKey | QIZCZUHQJJEVEB-SJBKTWHCSA-N |
| XLogP | 3.95 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|