C26H30NO5S+ — CID 139914169
[1-[bis(4-methoxyphenyl)methyl]-1-methylazetidin-1-ium-3-yl] 4-methylbenzenesulfonate (PubChem CID 139914169) has the molecular formula C26H30NO5S+ and a molecular weight of 468.60 g/mol. Its IUPAC name is [1-[bis(4-methoxyphenyl)methyl]-1-methylazetidin-1-ium-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [1-[bis(4-methoxyphenyl)methyl]-1-methylazetidin-1-ium-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139914169 |
| Molecular Formula | C26H30NO5S+ |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | [1-[bis(4-methoxyphenyl)methyl]-1-methylazetidin-1-ium-3-yl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(C(c2ccc(OC)cc2)[N+]2(C)CC(OS(=O)(=O)c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C26H30NO5S/c1-19-5-15-25(16-6-19)33(28,29)32-24-17-27(2,18-24)26(20-7-11-22(30-3)12-8-20)21-9-13-23(31-4)14-10-21/h5-16,24,26H,17-18H2,1-4H3/q+1 |
| InChIKey | HNJUUQNUWBCHCV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|