C18H22ClNO3S — CID 15525977
2-chloro-1-(4-methoxyphenyl)-N,N-dimethyl-2-(4-methylphenyl)sulfonylethanamine (PubChem CID 15525977) has the molecular formula C18H22ClNO3S and a molecular weight of 367.90 g/mol. Its IUPAC name is 2-chloro-1-(4-methoxyphenyl)-N,N-dimethyl-2-(4-methylphenyl)sulfonylethanamine.
| Compound Name | 2-chloro-1-(4-methoxyphenyl)-N,N-dimethyl-2-(4-methylphenyl)sulfonylethanamine |
|---|---|
| PubChem CID | 15525977 |
| Molecular Formula | C18H22ClNO3S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-chloro-1-(4-methoxyphenyl)-N,N-dimethyl-2-(4-methylphenyl)sulfonylethanamine |
| SMILES | COc1ccc(C(C(Cl)S(=O)(=O)c2ccc(C)cc2)N(C)C)cc1 |
| InChI | InChI=1S/C18H22ClNO3S/c1-13-5-11-16(12-6-13)24(21,22)18(19)17(20(2)3)14-7-9-15(23-4)10-8-14/h5-12,17-18H,1-4H3 |
| InChIKey | RDGZKHXERMQMPW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|