C20H25NO5S — CID 10287389
tert-butyl N-[(4-methoxyphenyl)-(4-methylphenyl)sulfonylmethyl]carbamate (PubChem CID 10287389) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is tert-butyl N-[(4-methoxyphenyl)-(4-methylphenyl)sulfonylmethyl]carbamate.
| Compound Name | tert-butyl N-[(4-methoxyphenyl)-(4-methylphenyl)sulfonylmethyl]carbamate |
|---|---|
| PubChem CID | 10287389 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | tert-butyl N-[(4-methoxyphenyl)-(4-methylphenyl)sulfonylmethyl]carbamate |
| SMILES | COc1ccc(C(NC(=O)OC(C)(C)C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H25NO5S/c1-14-6-12-17(13-7-14)27(23,24)18(21-19(22)26-20(2,3)4)15-8-10-16(25-5)11-9-15/h6-13,18H,1-5H3,(H,21,22) |
| InChIKey | IQKVGORNZUVCMF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |