C20H26N2O5S — CID 101378488
tert-butyl N-[(4-methoxyphenyl)-[(4-methylphenyl)sulfonylamino]methyl]carbamate (PubChem CID 101378488) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is tert-butyl N-[(4-methoxyphenyl)-[(4-methylphenyl)sulfonylamino]methyl]carbamate.
| Compound Name | tert-butyl N-[(4-methoxyphenyl)-[(4-methylphenyl)sulfonylamino]methyl]carbamate |
|---|---|
| PubChem CID | 101378488 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | tert-butyl N-[(4-methoxyphenyl)-[(4-methylphenyl)sulfonylamino]methyl]carbamate |
| SMILES | COc1ccc(C(NC(=O)OC(C)(C)C)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H26N2O5S/c1-14-6-12-17(13-7-14)28(24,25)22-18(21-19(23)27-20(2,3)4)15-8-10-16(26-5)11-9-15/h6-13,18,22H,1-5H3,(H,21,23) |
| InChIKey | UIZLSZXFDXJJCS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|