C15H16N2O5S — CID 23110204
[(6-methoxy-3-pyridinyl)-(4-methylphenyl)sulfonylmethyl]carbamic acid (PubChem CID 23110204) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is [(6-methoxy-3-pyridinyl)-(4-methylphenyl)sulfonylmethyl]carbamic acid.
| Compound Name | [(6-methoxy-3-pyridinyl)-(4-methylphenyl)sulfonylmethyl]carbamic acid |
|---|---|
| PubChem CID | 23110204 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [(6-methoxy-3-pyridinyl)-(4-methylphenyl)sulfonylmethyl]carbamic acid |
| SMILES | COc1ccc(C(NC(=O)O)S(=O)(=O)c2ccc(C)cc2)cn1 |
| InChI | InChI=1S/C15H16N2O5S/c1-10-3-6-12(7-4-10)23(20,21)14(17-15(18)19)11-5-8-13(22-2)16-9-11/h3-9,14,17H,1-2H3,(H,18,19) |
| InChIKey | JBKLQMXDCSRAJR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |