C20H29N2O6S+ — CID 66524855
[(1S)-1-(6-methoxy-3-pyridinyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]azanium;4-methylbenzenesulfonic acid (PubChem CID 66524855) has the molecular formula C20H29N2O6S+ and a molecular weight of 425.53 g/mol. Its IUPAC name is [(1S)-1-(6-methoxy-3-pyridinyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]azanium;4-methylbenzenesulfonic acid.
| Compound Name | [(1S)-1-(6-methoxy-3-pyridinyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]azanium;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 66524855 |
| Molecular Formula | C20H29N2O6S+ |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | [(1S)-1-(6-methoxy-3-pyridinyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]azanium;4-methylbenzenesulfonic acid |
| SMILES | COc1ccc([C@@H]([NH3+])CC(=O)OC(C)(C)C)cn1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C13H20N2O3.C7H8O3S/c1-13(2,3)18-12(16)7-10(14)9-5-6-11(17-4)15-8-9;1-6-2-4-7(5-3-6)11(8,9)10/h5-6,8,10H,7,14H2,1-4H3;2-5H,1H3,(H,8,9,10)/p+1/t10-;/m0./s1 |
| InChIKey | DJYVDYUFAMDHHQ-PPHPATTJSA-O |
| XLogP | 2.35 |
| TPSA | 130.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|