C15H17NO5S — CID 87185696
[(2S)-2-hydroxy-2-(6-methoxy-3-pyridinyl)ethyl] 4-methylbenzenesulfonate (PubChem CID 87185696) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-(6-methoxy-3-pyridinyl)ethyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-hydroxy-2-(6-methoxy-3-pyridinyl)ethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87185696 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | [(2S)-2-hydroxy-2-(6-methoxy-3-pyridinyl)ethyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc([C@H](O)COS(=O)(=O)c2ccc(C)cc2)cn1 |
| InChI | InChI=1S/C15H17NO5S/c1-11-3-6-13(7-4-11)22(18,19)21-10-14(17)12-5-8-15(20-2)16-9-12/h3-9,14,17H,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | XCIWHKVDGNMJBI-CQSZACIVSA-N |
| XLogP | 1.84 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|