C15H14Cl2O4S — CID 23242292
[2-(3,4-dichlorophenyl)-2-hydroxyethyl] 4-methylbenzenesulfonate (PubChem CID 23242292) has the molecular formula C15H14Cl2O4S and a molecular weight of 361.25 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-hydroxyethyl] 4-methylbenzenesulfonate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-hydroxyethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23242292 |
| Molecular Formula | C15H14Cl2O4S |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-hydroxyethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(O)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H14Cl2O4S/c1-10-2-5-12(6-3-10)22(19,20)21-9-15(18)11-4-7-13(16)14(17)8-11/h2-8,15,18H,9H2,1H3 |
| InChIKey | LOQAOCOGRDJZOF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|