C9H10Cl2O4S — CID 87402550
[(2R)-2-(3,4-dichlorophenyl)-2-hydroxyethyl] methanesulfonate (PubChem CID 87402550) has the molecular formula C9H10Cl2O4S and a molecular weight of 285.15 g/mol. Its IUPAC name is [(2R)-2-(3,4-dichlorophenyl)-2-hydroxyethyl] methanesulfonate.
| Compound Name | [(2R)-2-(3,4-dichlorophenyl)-2-hydroxyethyl] methanesulfonate |
|---|---|
| PubChem CID | 87402550 |
| Molecular Formula | C9H10Cl2O4S |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | [(2R)-2-(3,4-dichlorophenyl)-2-hydroxyethyl] methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@H](O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2O4S/c1-16(13,14)15-5-9(12)6-2-3-7(10)8(11)4-6/h2-4,9,12H,5H2,1H3/t9-/m0/s1 |
| InChIKey | FIVBHZMYSBKXSJ-VIFPVBQESA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|