C15H14ClFO4S — CID 118276750
[(2S)-2-(3-chloro-4-fluorophenyl)-2-hydroxyethyl] 4-methylbenzenesulfonate (PubChem CID 118276750) has the molecular formula C15H14ClFO4S and a molecular weight of 344.79 g/mol. Its IUPAC name is [(2S)-2-(3-chloro-4-fluorophenyl)-2-hydroxyethyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-(3-chloro-4-fluorophenyl)-2-hydroxyethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118276750 |
| Molecular Formula | C15H14ClFO4S |
| Molecular Weight | 344.79 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | [(2S)-2-(3-chloro-4-fluorophenyl)-2-hydroxyethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H14ClFO4S/c1-10-2-5-12(6-3-10)22(19,20)21-9-15(18)11-4-7-14(17)13(16)8-11/h2-8,15,18H,9H2,1H3/t15-/m1/s1 |
| InChIKey | IKCMGSIWIYGDPJ-OAHLLOKOSA-N |
| XLogP | 3.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.79 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|