C16H16F2O5S — CID 71817344
[(2S)-3-(3,4-difluorophenoxy)-2-hydroxypropyl] 4-methylbenzenesulfonate (PubChem CID 71817344) has the molecular formula C16H16F2O5S and a molecular weight of 358.36 g/mol. Its IUPAC name is [(2S)-3-(3,4-difluorophenoxy)-2-hydroxypropyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-3-(3,4-difluorophenoxy)-2-hydroxypropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 71817344 |
| Molecular Formula | C16H16F2O5S |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | [(2S)-3-(3,4-difluorophenoxy)-2-hydroxypropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)COc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H16F2O5S/c1-11-2-5-14(6-3-11)24(20,21)23-10-12(19)9-22-13-4-7-15(17)16(18)8-13/h2-8,12,19H,9-10H2,1H3/t12-/m0/s1 |
| InChIKey | UNYCFCFIBMGKMB-LBPRGKRZSA-N |
| XLogP | 2.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|