C18H24NO7S2+ — CID 59915616
[(2S,3S)-3-hydroxy-1,4-bis-(4-methylphenyl)sulfonyloxybutan-2-yl]azanium (PubChem CID 59915616) has the molecular formula C18H24NO7S2+ and a molecular weight of 430.52 g/mol. Its IUPAC name is [(2S,3S)-3-hydroxy-1,4-bis-(4-methylphenyl)sulfonyloxybutan-2-yl]azanium.
| Compound Name | [(2S,3S)-3-hydroxy-1,4-bis-(4-methylphenyl)sulfonyloxybutan-2-yl]azanium |
|---|---|
| PubChem CID | 59915616 |
| Molecular Formula | C18H24NO7S2+ |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | [(2S,3S)-3-hydroxy-1,4-bis-(4-methylphenyl)sulfonyloxybutan-2-yl]azanium |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)[C@@H]([NH3+])COS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H23NO7S2/c1-13-3-7-15(8-4-13)27(21,22)25-11-17(19)18(20)12-26-28(23,24)16-9-5-14(2)6-10-16/h3-10,17-18,20H,11-12,19H2,1-2H3/p+1/t17-,18+/m0/s1 |
| InChIKey | HKTBEYGGMJBNNL-ZWKOTPCHSA-O |
| XLogP | 0.39 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|