C19H20N2O4S — CID 124581087
tert-butyl N-[(R)-benzenesulfonyl-(4-cyanophenyl)methyl]carbamate (PubChem CID 124581087) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is tert-butyl N-[(R)-benzenesulfonyl-(4-cyanophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(R)-benzenesulfonyl-(4-cyanophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 124581087 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | tert-butyl N-[(R)-benzenesulfonyl-(4-cyanophenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccc(C#N)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-19(2,3)25-18(22)21-17(15-11-9-14(13-20)10-12-15)26(23,24)16-7-5-4-6-8-16/h4-12,17H,1-3H3,(H,21,22)/t17-/m1/s1 |
| InChIKey | WRSNHXTZVJGPKK-QGZVFWFLSA-N |
| XLogP | 3.56 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |