C25H27NO5S — CID 71268083
tert-butyl N-[benzenesulfonyl-(3-phenylmethoxyphenyl)methyl]carbamate (PubChem CID 71268083) has the molecular formula C25H27NO5S and a molecular weight of 453.56 g/mol. Its IUPAC name is tert-butyl N-[benzenesulfonyl-(3-phenylmethoxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[benzenesulfonyl-(3-phenylmethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 71268083 |
| Molecular Formula | C25H27NO5S |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | tert-butyl N-[benzenesulfonyl-(3-phenylmethoxyphenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(c1cccc(OCc2ccccc2)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H27NO5S/c1-25(2,3)31-24(27)26-23(32(28,29)22-15-8-5-9-16-22)20-13-10-14-21(17-20)30-18-19-11-6-4-7-12-19/h4-17,23H,18H2,1-3H3,(H,26,27) |
| InChIKey | HRIDBUIBQAZHNU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |