C19H20F3NO4S — CID 59536907
tert-butyl N-[benzenesulfonyl-[3-(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 59536907) has the molecular formula C19H20F3NO4S and a molecular weight of 415.43 g/mol. Its IUPAC name is tert-butyl N-[benzenesulfonyl-[3-(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[benzenesulfonyl-[3-(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59536907 |
| Molecular Formula | C19H20F3NO4S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | tert-butyl N-[benzenesulfonyl-[3-(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20F3NO4S/c1-18(2,3)27-17(24)23-16(28(25,26)15-10-5-4-6-11-15)13-8-7-9-14(12-13)19(20,21)22/h4-12,16H,1-3H3,(H,23,24) |
| InChIKey | VCNWBXIKBYVQJR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |