C22H28FNO6S2 — CID 102082029
tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluoro-3-methylbutan-2-yl]carbamate (PubChem CID 102082029) has the molecular formula C22H28FNO6S2 and a molecular weight of 485.60 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluoro-3-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluoro-3-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 102082029 |
| Molecular Formula | C22H28FNO6S2 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | tert-butyl N-[(2S)-1,1-bis(benzenesulfonyl)-1-fluoro-3-methylbutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)OC(C)(C)C)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H28FNO6S2/c1-16(2)19(24-20(25)30-21(3,4)5)22(23,31(26,27)17-12-8-6-9-13-17)32(28,29)18-14-10-7-11-15-18/h6-16,19H,1-5H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | KZVXVFBEYNJDJD-IBGZPJMESA-N |
| XLogP | 4.11 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |