C29H28FNO6S2 — CID 102082022
tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-naphthalen-2-ylethyl]carbamate (PubChem CID 102082022) has the molecular formula C29H28FNO6S2 and a molecular weight of 569.68 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-naphthalen-2-ylethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-naphthalen-2-ylethyl]carbamate |
|---|---|
| PubChem CID | 102082022 |
| Molecular Formula | C29H28FNO6S2 |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | tert-butyl N-[(1S)-2,2-bis(benzenesulfonyl)-2-fluoro-1-naphthalen-2-ylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](c1ccc2ccccc2c1)C(F)(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H28FNO6S2/c1-28(2,3)37-27(32)31-26(23-19-18-21-12-10-11-13-22(21)20-23)29(30,38(33,34)24-14-6-4-7-15-24)39(35,36)25-16-8-5-9-17-25/h4-20,26H,1-3H3,(H,31,32)/t26-/m0/s1 |
| InChIKey | IUOHEKONZLEHBX-SANMLTNESA-N |
| XLogP | 5.98 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |