C17H21NO3S — CID 110288005
N-[2-(4-methoxyphenyl)ethyl]-N,4-dimethylbenzenesulfonamide (PubChem CID 110288005) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 110288005 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-N,4-dimethylbenzenesulfonamide |
| SMILES | COc1ccc(CCN(C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H21NO3S/c1-14-4-10-17(11-5-14)22(19,20)18(2)13-12-15-6-8-16(21-3)9-7-15/h4-11H,12-13H2,1-3H3 |
| InChIKey | YMHVGSLRRMCMLP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |