C22H28NO6PS — CID 134849971
N-(2-diethoxyphosphorylethynyl)-N-[2-(4-methoxyphenyl)ethyl]-4-methylbenzenesulfonamide (PubChem CID 134849971) has the molecular formula C22H28NO6PS and a molecular weight of 465.51 g/mol. Its IUPAC name is N-(2-diethoxyphosphorylethynyl)-N-[2-(4-methoxyphenyl)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-(2-diethoxyphosphorylethynyl)-N-[2-(4-methoxyphenyl)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134849971 |
| Molecular Formula | C22H28NO6PS |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | N-(2-diethoxyphosphorylethynyl)-N-[2-(4-methoxyphenyl)ethyl]-4-methylbenzenesulfonamide |
| SMILES | CCOP(=O)(C#CN(CCc1ccc(OC)cc1)S(=O)(=O)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C22H28NO6PS/c1-5-28-30(24,29-6-2)18-17-23(16-15-20-9-11-21(27-4)12-10-20)31(25,26)22-13-7-19(3)8-14-22/h7-14H,5-6,15-16H2,1-4H3 |
| InChIKey | YZHCMJCREBLLIY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|