C28H31N2O7PS — CID 134849395
N-(4-diethoxyphosphoryl-3-phenyl-1,2-oxazol-5-yl)-N-[(4-methoxyphenyl)methyl]-4-methylbenzenesulfonamide (PubChem CID 134849395) has the molecular formula C28H31N2O7PS and a molecular weight of 570.60 g/mol. Its IUPAC name is N-(4-diethoxyphosphoryl-3-phenyl-1,2-oxazol-5-yl)-N-[(4-methoxyphenyl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-(4-diethoxyphosphoryl-3-phenyl-1,2-oxazol-5-yl)-N-[(4-methoxyphenyl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134849395 |
| Molecular Formula | C28H31N2O7PS |
| Molecular Weight | 570.60 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | N-(4-diethoxyphosphoryl-3-phenyl-1,2-oxazol-5-yl)-N-[(4-methoxyphenyl)methyl]-4-methylbenzenesulfonamide |
| SMILES | CCOP(=O)(OCC)c1c(-c2ccccc2)noc1N(Cc1ccc(OC)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H31N2O7PS/c1-5-35-38(31,36-6-2)27-26(23-10-8-7-9-11-23)29-37-28(27)30(20-22-14-16-24(34-4)17-15-22)39(32,33)25-18-12-21(3)13-19-25/h7-19H,5-6,20H2,1-4H3 |
| InChIKey | CHJKTURQPXGIRO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 108.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.60 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|