C23H22N4O3S — CID 141009707
4-methoxy-N-(1-methyl-3-phenylpyrazol-4-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide (PubChem CID 141009707) has the molecular formula C23H22N4O3S and a molecular weight of 434.52 g/mol. Its IUPAC name is 4-methoxy-N-(1-methyl-3-phenylpyrazol-4-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide.
| Compound Name | 4-methoxy-N-(1-methyl-3-phenylpyrazol-4-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 141009707 |
| Molecular Formula | C23H22N4O3S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 4-methoxy-N-(1-methyl-3-phenylpyrazol-4-yl)-N-(pyridin-3-ylmethyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2cccnc2)c2cn(C)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N4O3S/c1-26-17-22(23(25-26)19-8-4-3-5-9-19)27(16-18-7-6-14-24-15-18)31(28,29)21-12-10-20(30-2)11-13-21/h3-15,17H,16H2,1-2H3 |
| InChIKey | WAELWHWFLGZMNW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |