C29H29N5O7S — CID 70072848
hydroxylamine;2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-8-phenylquinoline-3-carboxylic acid (PubChem CID 70072848) has the molecular formula C29H29N5O7S and a molecular weight of 591.65 g/mol. Its IUPAC name is hydroxylamine;2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-8-phenylquinoline-3-carboxylic acid.
| Compound Name | hydroxylamine;2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-8-phenylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 70072848 |
| Molecular Formula | C29H29N5O7S |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | hydroxylamine;2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-8-phenylquinoline-3-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2cccnc2)c2nc3c(-c4ccccc4)cccc3cc2C(=O)O)cc1.NO.NO |
| InChI | InChI=1S/C29H23N3O5S.2H3NO/c1-37-23-12-14-24(15-13-23)38(35,36)32(19-20-7-6-16-30-18-20)28-26(29(33)34)17-22-10-5-11-25(27(22)31-28)21-8-3-2-4-9-21;2*1-2/h2-18H,19H2,1H3,(H,33,34);2*2H,1H2 |
| InChIKey | HNLQDGNRIPJZLT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 202.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|