C28H24F3N3O6S — CID 70126163
amino 2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methyl-5-[4-(trifluoromethoxy)phenyl]benzoate (PubChem CID 70126163) has the molecular formula C28H24F3N3O6S and a molecular weight of 587.58 g/mol. Its IUPAC name is amino 2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methyl-5-[4-(trifluoromethoxy)phenyl]benzoate.
| Compound Name | amino 2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methyl-5-[4-(trifluoromethoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 70126163 |
| Molecular Formula | C28H24F3N3O6S |
| Molecular Weight | 587.58 g/mol |
| Exact Mass | 587.13 |
| IUPAC Name | amino 2-[(4-methoxyphenyl)sulfonyl-(pyridin-3-ylmethyl)amino]-3-methyl-5-[4-(trifluoromethoxy)phenyl]benzoate |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2cccnc2)c2c(C)cc(-c3ccc(OC(F)(F)F)cc3)cc2C(=O)ON)cc1 |
| InChI | InChI=1S/C28H24F3N3O6S/c1-18-14-21(20-5-7-23(8-6-20)39-28(29,30)31)15-25(27(35)40-32)26(18)34(17-19-4-3-13-33-16-19)41(36,37)24-11-9-22(38-2)10-12-24/h3-16H,17,32H2,1-2H3 |
| InChIKey | OVBRVBUMUUZFFF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.58 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|