C29H27NO5S — CID 15859210
benzyl 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-methylbenzoate (PubChem CID 15859210) has the molecular formula C29H27NO5S and a molecular weight of 501.60 g/mol. Its IUPAC name is benzyl 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-methylbenzoate.
| Compound Name | benzyl 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-methylbenzoate |
|---|---|
| PubChem CID | 15859210 |
| Molecular Formula | C29H27NO5S |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | benzyl 2-[benzyl-(4-methoxyphenyl)sulfonylamino]-3-methylbenzoate |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)c2c(C)cccc2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H27NO5S/c1-22-10-9-15-27(29(31)35-21-24-13-7-4-8-14-24)28(22)30(20-23-11-5-3-6-12-23)36(32,33)26-18-16-25(34-2)17-19-26/h3-19H,20-21H2,1-2H3 |
| InChIKey | ICQNNUITENEWQH-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |