C29H26NO4PS — CID 134850121
N-(2-diphenylphosphorylethynyl)-N-[(4-methoxyphenyl)methyl]-4-methylbenzenesulfonamide (PubChem CID 134850121) has the molecular formula C29H26NO4PS and a molecular weight of 515.57 g/mol. Its IUPAC name is N-(2-diphenylphosphorylethynyl)-N-[(4-methoxyphenyl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-(2-diphenylphosphorylethynyl)-N-[(4-methoxyphenyl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134850121 |
| Molecular Formula | C29H26NO4PS |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | N-(2-diphenylphosphorylethynyl)-N-[(4-methoxyphenyl)methyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(CN(C#CP(=O)(c2ccccc2)c2ccccc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H26NO4PS/c1-24-13-19-29(20-14-24)36(32,33)30(23-25-15-17-26(34-2)18-16-25)21-22-35(31,27-9-5-3-6-10-27)28-11-7-4-8-12-28/h3-20H,23H2,1-2H3 |
| InChIKey | DLEVOYLIXXOMIH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|