C25H23NO2S — CID 135074869
N-benzyl-4-methyl-N-[(E)-4-(4-methylphenyl)but-3-en-1-ynyl]benzenesulfonamide (PubChem CID 135074869) has the molecular formula C25H23NO2S and a molecular weight of 401.53 g/mol. Its IUPAC name is N-benzyl-4-methyl-N-[(E)-4-(4-methylphenyl)but-3-en-1-ynyl]benzenesulfonamide.
| Compound Name | N-benzyl-4-methyl-N-[(E)-4-(4-methylphenyl)but-3-en-1-ynyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135074869 |
| Molecular Formula | C25H23NO2S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-benzyl-4-methyl-N-[(E)-4-(4-methylphenyl)but-3-en-1-ynyl]benzenesulfonamide |
| SMILES | Cc1ccc(/C=C/C#CN(Cc2ccccc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H23NO2S/c1-21-11-15-23(16-12-21)8-6-7-19-26(20-24-9-4-3-5-10-24)29(27,28)25-17-13-22(2)14-18-25/h3-6,8-18H,20H2,1-2H3/b8-6+ |
| InChIKey | WGWJMLXYOVYHII-SOFGYWHQSA-N |
| XLogP | 5.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|