C20H19NO4S2 — CID 56647729
N-(benzenesulfonyl)-N-[(4-methylphenyl)methyl]benzenesulfonamide (PubChem CID 56647729) has the molecular formula C20H19NO4S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-(benzenesulfonyl)-N-[(4-methylphenyl)methyl]benzenesulfonamide.
| Compound Name | N-(benzenesulfonyl)-N-[(4-methylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56647729 |
| Molecular Formula | C20H19NO4S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | N-(benzenesulfonyl)-N-[(4-methylphenyl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(CN(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19NO4S2/c1-17-12-14-18(15-13-17)16-21(26(22,23)19-8-4-2-5-9-19)27(24,25)20-10-6-3-7-11-20/h2-15H,16H2,1H3 |
| InChIKey | AUJBUXAGCXIXCY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |