C23H23NO4S — CID 11825728
(2S)-2-[benzyl-(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid (PubChem CID 11825728) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is (2S)-2-[benzyl-(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[benzyl-(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11825728 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (2S)-2-[benzyl-(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccccc2)[C@@H](Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C23H23NO4S/c1-18-12-14-21(15-13-18)29(27,28)24(17-20-10-6-3-7-11-20)22(23(25)26)16-19-8-4-2-5-9-19/h2-15,22H,16-17H2,1H3,(H,25,26)/t22-/m0/s1 |
| InChIKey | GVSLSAXYOQOAIY-QFIPXVFZSA-N |
| XLogP | 3.88 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |