C25H25NO3S — CID 10971835
N-benzyl-N-[(2S,3R)-3-hydroxy-1-phenylpent-4-yn-2-yl]-4-methylbenzenesulfonamide (PubChem CID 10971835) has the molecular formula C25H25NO3S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-benzyl-N-[(2S,3R)-3-hydroxy-1-phenylpent-4-yn-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-benzyl-N-[(2S,3R)-3-hydroxy-1-phenylpent-4-yn-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10971835 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-benzyl-N-[(2S,3R)-3-hydroxy-1-phenylpent-4-yn-2-yl]-4-methylbenzenesulfonamide |
| SMILES | C#C[C@@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H25NO3S/c1-3-25(27)24(18-21-10-6-4-7-11-21)26(19-22-12-8-5-9-13-22)30(28,29)23-16-14-20(2)15-17-23/h1,4-17,24-25,27H,18-19H2,2H3/t24-,25+/m0/s1 |
| InChIKey | YNWCSPVZDYWPLE-LOSJGSFVSA-N |
| XLogP | 3.79 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|