C28H33NO3SSi — CID 10896283
N-benzyl-N-[(2S,3R)-3-hydroxy-1-phenyl-5-trimethylsilylpent-4-yn-2-yl]-4-methylbenzenesulfonamide (PubChem CID 10896283) has the molecular formula C28H33NO3SSi and a molecular weight of 491.73 g/mol. Its IUPAC name is N-benzyl-N-[(2S,3R)-3-hydroxy-1-phenyl-5-trimethylsilylpent-4-yn-2-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-benzyl-N-[(2S,3R)-3-hydroxy-1-phenyl-5-trimethylsilylpent-4-yn-2-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10896283 |
| Molecular Formula | C28H33NO3SSi |
| Molecular Weight | 491.73 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N-benzyl-N-[(2S,3R)-3-hydroxy-1-phenyl-5-trimethylsilylpent-4-yn-2-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccccc2)[C@@H](Cc2ccccc2)[C@H](O)C#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C28H33NO3SSi/c1-23-15-17-26(18-16-23)33(31,32)29(22-25-13-9-6-10-14-25)27(21-24-11-7-5-8-12-24)28(30)19-20-34(2,3)4/h5-18,27-28,30H,21-22H2,1-4H3/t27-,28+/m0/s1 |
| InChIKey | KRHYYJQFJDUIKK-WUFINQPMSA-N |
| XLogP | 5.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.73 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|