C23H31NO4S — CID 100984415
tert-butyl (2S)-2-[benzyl-(4-methylphenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 100984415) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-[benzyl-(4-methylphenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[benzyl-(4-methylphenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 100984415 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | tert-butyl (2S)-2-[benzyl-(4-methylphenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccccc2)[C@H](C(=O)OC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C23H31NO4S/c1-17(2)21(22(25)28-23(4,5)6)24(16-19-10-8-7-9-11-19)29(26,27)20-14-12-18(3)13-15-20/h7-15,17,21H,16H2,1-6H3/t21-/m0/s1 |
| InChIKey | PEZYIJLOBZQCAI-NRFANRHFSA-N |
| XLogP | 4.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |