C24H29F2NO5S — CID 89120334
tert-butyl 2-[benzyl-[4-(2-fluoroethoxy)phenyl]sulfonylamino]-4-fluoropent-4-enoate (PubChem CID 89120334) has the molecular formula C24H29F2NO5S and a molecular weight of 481.56 g/mol. Its IUPAC name is tert-butyl 2-[benzyl-[4-(2-fluoroethoxy)phenyl]sulfonylamino]-4-fluoropent-4-enoate.
| Compound Name | tert-butyl 2-[benzyl-[4-(2-fluoroethoxy)phenyl]sulfonylamino]-4-fluoropent-4-enoate |
|---|---|
| PubChem CID | 89120334 |
| Molecular Formula | C24H29F2NO5S |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | tert-butyl 2-[benzyl-[4-(2-fluoroethoxy)phenyl]sulfonylamino]-4-fluoropent-4-enoate |
| SMILES | C=C(F)CC(C(=O)OC(C)(C)C)N(Cc1ccccc1)S(=O)(=O)c1ccc(OCCF)cc1 |
| InChI | InChI=1S/C24H29F2NO5S/c1-18(26)16-22(23(28)32-24(2,3)4)27(17-19-8-6-5-7-9-19)33(29,30)21-12-10-20(11-13-21)31-15-14-25/h5-13,22H,1,14-17H2,2-4H3 |
| InChIKey | KUJKCANNXMBIRW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |