C18H24ClFO5S — CID 160725579
tert-butyl (2R)-2-[[4-(2-chloroethoxy)phenyl]sulfonylmethyl]-4-fluoropent-4-enoate (PubChem CID 160725579) has the molecular formula C18H24ClFO5S and a molecular weight of 406.90 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[4-(2-chloroethoxy)phenyl]sulfonylmethyl]-4-fluoropent-4-enoate.
| Compound Name | tert-butyl (2R)-2-[[4-(2-chloroethoxy)phenyl]sulfonylmethyl]-4-fluoropent-4-enoate |
|---|---|
| PubChem CID | 160725579 |
| Molecular Formula | C18H24ClFO5S |
| Molecular Weight | 406.90 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | tert-butyl (2R)-2-[[4-(2-chloroethoxy)phenyl]sulfonylmethyl]-4-fluoropent-4-enoate |
| SMILES | C=C(F)C[C@@H](CS(=O)(=O)c1ccc(OCCCl)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H24ClFO5S/c1-13(20)11-14(17(21)25-18(2,3)4)12-26(22,23)16-7-5-15(6-8-16)24-10-9-19/h5-8,14H,1,9-12H2,2-4H3/t14-/m0/s1 |
| InChIKey | RTQXMXDXJCALTM-AWEZNQCLSA-N |
| XLogP | 3.91 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.90 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|