C24H30FNO8S2 — CID 89120316
tert-butyl (2S)-4-fluoro-2-[[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]sulfonylamino]pent-4-enoate (PubChem CID 89120316) has the molecular formula C24H30FNO8S2 and a molecular weight of 543.64 g/mol. Its IUPAC name is tert-butyl (2S)-4-fluoro-2-[[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]sulfonylamino]pent-4-enoate.
| Compound Name | tert-butyl (2S)-4-fluoro-2-[[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]sulfonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 89120316 |
| Molecular Formula | C24H30FNO8S2 |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | tert-butyl (2S)-4-fluoro-2-[[4-[2-(4-methylphenyl)sulfonyloxyethoxy]phenyl]sulfonylamino]pent-4-enoate |
| SMILES | C=C(F)C[C@H](NS(=O)(=O)c1ccc(OCCOS(=O)(=O)c2ccc(C)cc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H30FNO8S2/c1-17-6-10-21(11-7-17)36(30,31)33-15-14-32-19-8-12-20(13-9-19)35(28,29)26-22(16-18(2)25)23(27)34-24(3,4)5/h6-13,22,26H,2,14-16H2,1,3-5H3/t22-/m0/s1 |
| InChIKey | KXVYYTRMIVJVEP-QFIPXVFZSA-N |
| XLogP | 3.64 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|