C14H18ClNO6S — CID 90891648
(3R)-3-[(4-chlorophenyl)sulfonylamino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (PubChem CID 90891648) has the molecular formula C14H18ClNO6S and a molecular weight of 363.82 g/mol. Its IUPAC name is (3R)-3-[(4-chlorophenyl)sulfonylamino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid.
| Compound Name | (3R)-3-[(4-chlorophenyl)sulfonylamino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90891648 |
| Molecular Formula | C14H18ClNO6S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | (3R)-3-[(4-chlorophenyl)sulfonylamino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@@H](CC(=O)O)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClNO6S/c1-14(2,3)22-13(19)11(8-12(17)18)16-23(20,21)10-6-4-9(15)5-7-10/h4-7,11,16H,8H2,1-3H3,(H,17,18)/t11-/m1/s1 |
| InChIKey | SFHCVWORLBLGAC-LLVKDONJSA-N |
| XLogP | 1.80 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |