C16H26N2O4S — CID 57187160
tert-butyl (2S)-2-(benzenesulfonamido)-3-(propylamino)propanoate (PubChem CID 57187160) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzenesulfonamido)-3-(propylamino)propanoate.
| Compound Name | tert-butyl (2S)-2-(benzenesulfonamido)-3-(propylamino)propanoate |
|---|---|
| PubChem CID | 57187160 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | tert-butyl (2S)-2-(benzenesulfonamido)-3-(propylamino)propanoate |
| SMILES | CCCNC[C@H](NS(=O)(=O)c1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26N2O4S/c1-5-11-17-12-14(15(19)22-16(2,3)4)18-23(20,21)13-9-7-6-8-10-13/h6-10,14,17-18H,5,11-12H2,1-4H3/t14-/m0/s1 |
| InChIKey | GSZYOKBEAFBHMC-AWEZNQCLSA-N |
| XLogP | 1.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|