C11H17ClN2O4S — CID 18664309
ethyl (2S)-3-amino-2-(benzenesulfonamido)propanoate;hydrochloride (PubChem CID 18664309) has the molecular formula C11H17ClN2O4S and a molecular weight of 308.79 g/mol. Its IUPAC name is ethyl (2S)-3-amino-2-(benzenesulfonamido)propanoate;hydrochloride.
| Compound Name | ethyl (2S)-3-amino-2-(benzenesulfonamido)propanoate;hydrochloride |
|---|---|
| PubChem CID | 18664309 |
| Molecular Formula | C11H17ClN2O4S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | ethyl (2S)-3-amino-2-(benzenesulfonamido)propanoate;hydrochloride |
| SMILES | CCOC(=O)[C@H](CN)NS(=O)(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C11H16N2O4S.ClH/c1-2-17-11(14)10(8-12)13-18(15,16)9-6-4-3-5-7-9;/h3-7,10,13H,2,8,12H2,1H3;1H/t10-;/m0./s1 |
| InChIKey | LQGJPDVUACKKJF-PPHPATTJSA-N |
| XLogP | 0.28 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |