C11H17ClN2O4S — CID 141092431
(2R)-4-amino-2-(benzenesulfonamido)-3-methylbutanoic acid;hydrochloride (PubChem CID 141092431) has the molecular formula C11H17ClN2O4S and a molecular weight of 308.79 g/mol. Its IUPAC name is (2R)-4-amino-2-(benzenesulfonamido)-3-methylbutanoic acid;hydrochloride.
| Compound Name | (2R)-4-amino-2-(benzenesulfonamido)-3-methylbutanoic acid;hydrochloride |
|---|---|
| PubChem CID | 141092431 |
| Molecular Formula | C11H17ClN2O4S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | (2R)-4-amino-2-(benzenesulfonamido)-3-methylbutanoic acid;hydrochloride |
| SMILES | CC(CN)[C@@H](NS(=O)(=O)c1ccccc1)C(=O)O.Cl |
| InChI | InChI=1S/C11H16N2O4S.ClH/c1-8(7-12)10(11(14)15)13-18(16,17)9-5-3-2-4-6-9;/h2-6,8,10,13H,7,12H2,1H3,(H,14,15);1H/t8?,10-;/m1./s1 |
| InChIKey | GVOZEJHSZRVJQT-JDXSOMNQSA-N |
| XLogP | 0.43 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |