C15H21NO4S — CID 139807925
prop-2-enyl (2S,3S)-2-(benzenesulfonamido)-3-methylpentanoate (PubChem CID 139807925) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is prop-2-enyl (2S,3S)-2-(benzenesulfonamido)-3-methylpentanoate.
| Compound Name | prop-2-enyl (2S,3S)-2-(benzenesulfonamido)-3-methylpentanoate |
|---|---|
| PubChem CID | 139807925 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | prop-2-enyl (2S,3S)-2-(benzenesulfonamido)-3-methylpentanoate |
| SMILES | C=CCOC(=O)[C@@H](NS(=O)(=O)c1ccccc1)[C@@H](C)CC |
| InChI | InChI=1S/C15H21NO4S/c1-4-11-20-15(17)14(12(3)5-2)16-21(18,19)13-9-7-6-8-10-13/h4,6-10,12,14,16H,1,5,11H2,2-3H3/t12-,14-/m0/s1 |
| InChIKey | DKFGPDQDDHTWIM-JSGCOSHPSA-N |
| XLogP | 2.11 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|