C10H15N3O4S — CID 70080026
methyl (2S)-3,3-diamino-2-(benzenesulfonamido)propanoate (PubChem CID 70080026) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is methyl (2S)-3,3-diamino-2-(benzenesulfonamido)propanoate.
| Compound Name | methyl (2S)-3,3-diamino-2-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 70080026 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | methyl (2S)-3,3-diamino-2-(benzenesulfonamido)propanoate |
| SMILES | COC(=O)[C@@H](NS(=O)(=O)c1ccccc1)C(N)N |
| InChI | InChI=1S/C10H15N3O4S/c1-17-10(14)8(9(11)12)13-18(15,16)7-5-3-2-4-6-7/h2-6,8-9,13H,11-12H2,1H3/t8-/m0/s1 |
| InChIKey | SQXIFPPRHSDHDD-QMMMGPOBSA-N |
| XLogP | -1.25 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|