C12H17NO4S2 — CID 7426963
methyl (2S)-2-(benzenesulfonamido)-4-methylsulfanylbutanoate (PubChem CID 7426963) has the molecular formula C12H17NO4S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is methyl (2S)-2-(benzenesulfonamido)-4-methylsulfanylbutanoate.
| Compound Name | methyl (2S)-2-(benzenesulfonamido)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7426963 |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | methyl (2S)-2-(benzenesulfonamido)-4-methylsulfanylbutanoate |
| SMILES | COC(=O)[C@H](CCSC)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H17NO4S2/c1-17-12(14)11(8-9-18-2)13-19(15,16)10-6-4-3-5-7-10/h3-7,11,13H,8-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | TUNPYYXZRSMGIA-NSHDSACASA-N |
| XLogP | 1.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |