C20H19NO6S2 — CID 21233948
methyl 2-[(9,10-dioxoanthracen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate (PubChem CID 21233948) has the molecular formula C20H19NO6S2 and a molecular weight of 433.51 g/mol. Its IUPAC name is methyl 2-[(9,10-dioxoanthracen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-[(9,10-dioxoanthracen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 21233948 |
| Molecular Formula | C20H19NO6S2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | methyl 2-[(9,10-dioxoanthracen-2-yl)sulfonylamino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)C(CCSC)NS(=O)(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H19NO6S2/c1-27-20(24)17(9-10-28-2)21-29(25,26)12-7-8-15-16(11-12)19(23)14-6-4-3-5-13(14)18(15)22/h3-8,11,17,21H,9-10H2,1-2H3 |
| InChIKey | CYZVIKBLQZZKDN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|