C13H14N2O6S2 — CID 100820384
(2R)-2-[(1,3-dioxoisoindol-5-yl)sulfonylamino]-4-methylsulfanylbutanoic acid (PubChem CID 100820384) has the molecular formula C13H14N2O6S2 and a molecular weight of 358.40 g/mol. Its IUPAC name is (2R)-2-[(1,3-dioxoisoindol-5-yl)sulfonylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(1,3-dioxoisoindol-5-yl)sulfonylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 100820384 |
| Molecular Formula | C13H14N2O6S2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | (2R)-2-[(1,3-dioxoisoindol-5-yl)sulfonylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NS(=O)(=O)c1ccc2c(c1)C(=O)NC2=O)C(=O)O |
| InChI | InChI=1S/C13H14N2O6S2/c1-22-5-4-10(13(18)19)15-23(20,21)7-2-3-8-9(6-7)12(17)14-11(8)16/h2-3,6,10,15H,4-5H2,1H3,(H,18,19)(H,14,16,17)/t10-/m1/s1 |
| InChIKey | NAYMKTUPYBSMSZ-SNVBAGLBSA-N |
| XLogP | 0.05 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|