C14H20N2O5S2 — CID 7982750
[2-(methylamino)-2-oxoethyl] (2S)-2-(benzenesulfonamido)-4-methylsulfanylbutanoate (PubChem CID 7982750) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] (2S)-2-(benzenesulfonamido)-4-methylsulfanylbutanoate.
| Compound Name | [2-(methylamino)-2-oxoethyl] (2S)-2-(benzenesulfonamido)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7982750 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] (2S)-2-(benzenesulfonamido)-4-methylsulfanylbutanoate |
| SMILES | CNC(=O)COC(=O)[C@H](CCSC)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H20N2O5S2/c1-15-13(17)10-21-14(18)12(8-9-22-2)16-23(19,20)11-6-4-3-5-7-11/h3-7,12,16H,8-10H2,1-2H3,(H,15,17)/t12-/m0/s1 |
| InChIKey | QEWJZIMHAIHHCF-LBPRGKRZSA-N |
| XLogP | 0.38 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |