C12H13Cl2NO6S — CID 154155939
(3R)-3-[(3,4-dichlorophenyl)sulfonylamino]-4-ethoxy-4-oxobutanoic acid (PubChem CID 154155939) has the molecular formula C12H13Cl2NO6S and a molecular weight of 370.21 g/mol. Its IUPAC name is (3R)-3-[(3,4-dichlorophenyl)sulfonylamino]-4-ethoxy-4-oxobutanoic acid.
| Compound Name | (3R)-3-[(3,4-dichlorophenyl)sulfonylamino]-4-ethoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 154155939 |
| Molecular Formula | C12H13Cl2NO6S |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | (3R)-3-[(3,4-dichlorophenyl)sulfonylamino]-4-ethoxy-4-oxobutanoic acid |
| SMILES | CCOC(=O)[C@@H](CC(=O)O)NS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2NO6S/c1-2-21-12(18)10(6-11(16)17)15-22(19,20)7-3-4-8(13)9(14)5-7/h3-5,10,15H,2,6H2,1H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | YHNUXXBTRVMFSU-SNVBAGLBSA-N |
| XLogP | 1.68 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |